C18H26N4O4S — CID 136763856
(1S,10R)-5-methyl-13-(1-methylsulfonylpiperidine-4-carbonyl)-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136763856) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is (1S,10R)-5-methyl-13-(1-methylsulfonylpiperidine-4-carbonyl)-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-5-methyl-13-(1-methylsulfonylpiperidine-4-carbonyl)-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136763856 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (1S,10R)-5-methyl-13-(1-methylsulfonylpiperidine-4-carbonyl)-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@H]1CC[C@@H](C2)N1C(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H26N4O4S/c1-11-19-16-10-14-4-3-13(9-15(16)17(23)20-11)22(14)18(24)12-5-7-21(8-6-12)27(2,25)26/h12-14H,3-10H2,1-2H3,(H,19,20,23)/t13-,14+/m1/s1 |
| InChIKey | VLZDJOLZTMSLHZ-KGLIPLIRSA-N |
| XLogP | 0.21 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |