C20H23F2N3O3 — CID 136763882
(1S,10R)-13-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136763882) has the molecular formula C20H23F2N3O3 and a molecular weight of 391.42 g/mol. Its IUPAC name is (1S,10R)-13-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-13-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136763882 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (1S,10R)-13-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | COc1cc(CN2[C@@H]3CC[C@H]2Cc2nc(C)[nH]c(=O)c2C3)ccc1OC(F)F |
| InChI | InChI=1S/C20H23F2N3O3/c1-11-23-16-9-14-5-4-13(8-15(16)19(26)24-11)25(14)10-12-3-6-17(28-20(21)22)18(7-12)27-2/h3,6-7,13-14,20H,4-5,8-10H2,1-2H3,(H,23,24,26)/t13-,14+/m1/s1 |
| InChIKey | LDAGHZXEMALIOE-KGLIPLIRSA-N |
| XLogP | 2.82 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |