C19H23N3OS — CID 136763893
(1S,10R)-5-methyl-13-[(4-methylsulfanylphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136763893) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is (1S,10R)-5-methyl-13-[(4-methylsulfanylphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-5-methyl-13-[(4-methylsulfanylphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136763893 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (1S,10R)-5-methyl-13-[(4-methylsulfanylphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | CSc1ccc(CN2[C@@H]3CC[C@H]2Cc2nc(C)[nH]c(=O)c2C3)cc1 |
| InChI | InChI=1S/C19H23N3OS/c1-12-20-18-10-15-6-5-14(9-17(18)19(23)21-12)22(15)11-13-3-7-16(24-2)8-4-13/h3-4,7-8,14-15H,5-6,9-11H2,1-2H3,(H,20,21,23)/t14-,15+/m1/s1 |
| InChIKey | HNLGFJPBYMKRCE-CABCVRRESA-N |
| XLogP | 2.93 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |