C12H21N3O2 — CID 136764964
2-methyl-4-[3-(2-methylpropoxy)propylamino]-1H-pyrimidin-6-one (PubChem CID 136764964) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-methyl-4-[3-(2-methylpropoxy)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[3-(2-methylpropoxy)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136764964 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-methyl-4-[3-(2-methylpropoxy)propylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCCCOCC(C)C)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N3O2/c1-9(2)8-17-6-4-5-13-11-7-12(16)15-10(3)14-11/h7,9H,4-6,8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | CXHDJNHLKOMXPU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|