C25H28FN5O — CID 136765667
4-[1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 136765667) has the molecular formula C25H28FN5O and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136765667 |
| Molecular Formula | C25H28FN5O |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 4-[1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C2CCCN(Cc3ccc(N4CCCC4)c(F)c3)C2)nc(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C25H28FN5O/c26-21-14-18(5-6-23(21)31-12-1-2-13-31)16-30-11-3-4-20(17-30)22-15-24(32)29-25(28-22)19-7-9-27-10-8-19/h5-10,14-15,20H,1-4,11-13,16-17H2,(H,28,29,32) |
| InChIKey | DRZCDSWEPSHKGF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|