C24H28N4O3 — CID 136765807
4-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-pyridin-2-yl-1H-pyrimidin-6-one (PubChem CID 136765807) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-pyridin-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-pyridin-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136765807 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-pyridin-2-yl-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(CN2CCCC(c3cc(=O)[nH]c(-c4ccccn4)n3)C2)ccc1OC |
| InChI | InChI=1S/C24H28N4O3/c1-3-31-22-13-17(9-10-21(22)30-2)15-28-12-6-7-18(16-28)20-14-23(29)27-24(26-20)19-8-4-5-11-25-19/h4-5,8-11,13-14,18H,3,6-7,12,15-16H2,1-2H3,(H,26,27,29) |
| InChIKey | PHRJKIWLYPGECE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |