C20H25F2N5O2 — CID 136765985
1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 136765985) has the molecular formula C20H25F2N5O2 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 136765985 |
| Molecular Formula | C20H25F2N5O2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)N2CCC([C@@H]3C[C@H](C(F)F)n4ncnc4N3)CC2)c1 |
| InChI | InChI=1S/C20H25F2N5O2/c1-29-15-4-2-3-13(9-15)10-18(28)26-7-5-14(6-8-26)16-11-17(19(21)22)27-20(25-16)23-12-24-27/h2-4,9,12,14,16-17,19H,5-8,10-11H2,1H3,(H,23,24,25)/t16-,17+/m0/s1 |
| InChIKey | GTWPXMYTFGQALH-DLBZAZTESA-N |
| XLogP | 2.76 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |