C21H27F2N5O — CID 136766003
[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-ylmethanone (PubChem CID 136766003) has the molecular formula C21H27F2N5O and a molecular weight of 403.48 g/mol. Its IUPAC name is [4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-ylmethanone.
| Compound Name | [4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-ylmethanone |
|---|---|
| PubChem CID | 136766003 |
| Molecular Formula | C21H27F2N5O |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | [4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-ylmethanone |
| SMILES | O=C(C1CC2C=CC1C21CC1)N1CCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)CC1 |
| InChI | InChI=1S/C21H27F2N5O/c22-18(23)17-10-16(26-20-24-11-25-28(17)20)12-3-7-27(8-4-12)19(29)14-9-13-1-2-15(14)21(13)5-6-21/h1-2,11-18H,3-10H2,(H,24,25,26)/t13?,14?,15?,16-,17+/m0/s1 |
| InChIKey | OYGXDVOVDGCLMX-LSSJBHJESA-N |
| XLogP | 3.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|