C21H23N3O3S — CID 136766179
4-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-3-yl]-2-thiophen-2-yl-1H-pyrimidin-6-one (PubChem CID 136766179) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-3-yl]-2-thiophen-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-3-yl]-2-thiophen-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136766179 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-3-yl]-2-thiophen-2-yl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(O)c(CN2CCCC(c3cc(=O)[nH]c(-c4cccs4)n3)C2)c1 |
| InChI | InChI=1S/C21H23N3O3S/c1-27-16-6-7-18(25)15(10-16)13-24-8-2-4-14(12-24)17-11-20(26)23-21(22-17)19-5-3-9-28-19/h3,5-7,9-11,14,25H,2,4,8,12-13H2,1H3,(H,22,23,26) |
| InChIKey | LCFXJQIZVQWLQQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|