C17H25N3O2 — CID 136766212
5-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 136766212) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 5-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136766212 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(CC(=O)N2CCC[C@H]3CCCC[C@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C17H25N3O2/c1-11-14(17(22)19-12(2)18-11)10-16(21)20-9-5-7-13-6-3-4-8-15(13)20/h13,15H,3-10H2,1-2H3,(H,18,19,22)/t13-,15-/m1/s1 |
| InChIKey | FBDMIXIYRYWEMD-UKRRQHHQSA-N |
| XLogP | 2.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |