C15H18N6O — CID 136766428
(2S)-2-[4-(dimethylamino)phenyl]-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]acetonitrile (PubChem CID 136766428) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylamino)phenyl]-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]acetonitrile.
| Compound Name | (2S)-2-[4-(dimethylamino)phenyl]-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]acetonitrile |
|---|---|
| PubChem CID | 136766428 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-2-[4-(dimethylamino)phenyl]-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]acetonitrile |
| SMILES | Cc1cc(=O)[nH]c(NN[C@H](C#N)c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C15H18N6O/c1-10-8-14(22)18-15(17-10)20-19-13(9-16)11-4-6-12(7-5-11)21(2)3/h4-8,13,19H,1-3H3,(H2,17,18,20,22)/t13-/m1/s1 |
| InChIKey | QAYYSXWQFPEBMD-CYBMUJFWSA-N |
| XLogP | 1.33 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|