About 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one
5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 136766522) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136766522 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | Nc1c(N2CC(O)C(O)C2)nc[nH]c1=O |
| InChI | InChI=1S/C8H12N4O3/c9-6-7(10-3-11-8(6)15)12-1-4(13)5(14)2-12/h3-5,13-14H,1-2,9H2,(H,10,11,15) |
| InChIKey | DVMWYAGLZKVRMC-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one (CID 136766522) is 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one is Nc1c(N2CC(O)C(O)C2)nc[nH]c1=O.
What is the InChIKey of 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one?
The InChIKey is DVMWYAGLZKVRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c9-6-7(10-3-11-8(6)15)12-1-4(13)5(14)2-12/h3-5,13-14H,1-2,9H2,(H,10,11,15).
What are the key properties of 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one?
5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one has a molecular weight of 212.21 g/mol, XLogP of -2.11, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136766522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).