C9H5Br2N5OS — CID 136766848
2-amino-8-(2,5-dibromothiophen-3-yl)-1,7-dihydropurin-6-one (PubChem CID 136766848) has the molecular formula C9H5Br2N5OS and a molecular weight of 391.05 g/mol. Its IUPAC name is 2-amino-8-(2,5-dibromothiophen-3-yl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(2,5-dibromothiophen-3-yl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136766848 |
| Molecular Formula | C9H5Br2N5OS |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.86 |
| IUPAC Name | 2-amino-8-(2,5-dibromothiophen-3-yl)-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(-c3cc(Br)sc3Br)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H5Br2N5OS/c10-3-1-2(5(11)18-3)6-13-4-7(14-6)15-9(12)16-8(4)17/h1H,(H4,12,13,14,15,16,17) |
| InChIKey | PDIQMKJULCFZRO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |