C18H19N3O6 — CID 136766871
(2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-nitrophenoxy)propanamide (PubChem CID 136766871) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-nitrophenoxy)propanamide.
| Compound Name | (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 136766871 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-nitrophenoxy)propanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C)Oc2ccccc2[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C18H19N3O6/c1-3-26-17-10-13(8-9-15(17)22)11-19-20-18(23)12(2)27-16-7-5-4-6-14(16)21(24)25/h4-12,22H,3H2,1-2H3,(H,20,23)/b19-11-/t12-/m1/s1 |
| InChIKey | BTHLZLKPHJLGSE-ZDFPAGSVSA-N |
| XLogP | 2.62 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|