C24H19ClN4OS — CID 136767133
(4R)-5-(1H-benzimidazol-2-yl)-6-(3-chlorophenyl)-4-(4-methoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 136767133) has the molecular formula C24H19ClN4OS and a molecular weight of 446.96 g/mol. Its IUPAC name is (4R)-5-(1H-benzimidazol-2-yl)-6-(3-chlorophenyl)-4-(4-methoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | (4R)-5-(1H-benzimidazol-2-yl)-6-(3-chlorophenyl)-4-(4-methoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 136767133 |
| Molecular Formula | C24H19ClN4OS |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (4R)-5-(1H-benzimidazol-2-yl)-6-(3-chlorophenyl)-4-(4-methoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | COc1ccc([C@H]2NC(=S)NC(c3cccc(Cl)c3)=C2c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H19ClN4OS/c1-30-17-11-9-14(10-12-17)21-20(23-26-18-7-2-3-8-19(18)27-23)22(29-24(31)28-21)15-5-4-6-16(25)13-15/h2-13,21H,1H3,(H,26,27)(H2,28,29,31)/t21-/m1/s1 |
| InChIKey | WVGJKKHEIFMPHR-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|