About [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate
[4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate (PubChem CID 136768680) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate |
| PubChem CID | 136768680 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-n2nc(C)c3c(=O)[nH]c(C)cc32)cc1 |
| InChI | InChI=1S/C16H15N3O3/c1-9-8-14-15(16(21)17-9)10(2)18-19(14)12-4-6-13(7-5-12)22-11(3)20/h4-8H,1-3H3,(H,17,21) |
| InChIKey | HIZWWQNCPUOXDE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate?
The IUPAC name of [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate (CID 136768680) is [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate.
What is the SMILES notation for [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate?
The canonical SMILES for [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate is CC(=O)Oc1ccc(-n2nc(C)c3c(=O)[nH]c(C)cc32)cc1.
What is the InChIKey of [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate?
The InChIKey is HIZWWQNCPUOXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-9-8-14-15(16(21)17-9)10(2)18-19(14)12-4-6-13(7-5-12)22-11(3)20/h4-8H,1-3H3,(H,17,21).
What are the key properties of [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate?
[4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate has a molecular weight of 297.31 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,6-dimethyl-4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)phenyl] acetate is sourced from PubChem (CID 136768680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).