C21H21N5O5 — CID 136768778
(4S)-4-(3,4-dihydroxyphenyl)-2-(2,4-dimethoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 136768778) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is (4S)-4-(3,4-dihydroxyphenyl)-2-(2,4-dimethoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | (4S)-4-(3,4-dihydroxyphenyl)-2-(2,4-dimethoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 136768778 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (4S)-4-(3,4-dihydroxyphenyl)-2-(2,4-dimethoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccc(NC2=N[C@H](c3ccc(O)c(O)c3)n3c(nc(C)cc3=O)N2)c(OC)c1 |
| InChI | InChI=1S/C21H21N5O5/c1-11-8-18(29)26-19(12-4-7-15(27)16(28)9-12)24-20(25-21(26)22-11)23-14-6-5-13(30-2)10-17(14)31-3/h4-10,19,27-28H,1-3H3,(H2,22,23,24,25)/t19-/m0/s1 |
| InChIKey | BQISFGXGDZUDTA-IBGZPJMESA-N |
| XLogP | 2.42 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|