C11H12N2OS — CID 136770430
2,5-dimethyl-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one (PubChem CID 136770430) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2,5-dimethyl-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2,5-dimethyl-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136770430 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,5-dimethyl-4-(2-methylthiophen-3-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2ccsc2C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12N2OS/c1-6-10(9-4-5-15-7(9)2)12-8(3)13-11(6)14/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | UJVNGAXBVVMJQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |