C13H10ClFN2O — CID 136770507
4-(2-chloro-5-fluorophenyl)-2-cyclopropyl-1H-pyrimidin-6-one (PubChem CID 136770507) has the molecular formula C13H10ClFN2O and a molecular weight of 264.69 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)-2-cyclopropyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-chloro-5-fluorophenyl)-2-cyclopropyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136770507 |
| Molecular Formula | C13H10ClFN2O |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)-2-cyclopropyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cc(F)ccc2Cl)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C13H10ClFN2O/c14-10-4-3-8(15)5-9(10)11-6-12(18)17-13(16-11)7-1-2-7/h3-7H,1-2H2,(H,16,17,18) |
| InChIKey | URBLVDMCLVDABX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |