C11H14N4O3S — CID 136771755
4-(1-methylpyrazol-4-yl)-2-(1-methylsulfonylethyl)-1H-pyrimidin-6-one (PubChem CID 136771755) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-2-(1-methylsulfonylethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(1-methylpyrazol-4-yl)-2-(1-methylsulfonylethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136771755 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-2-(1-methylsulfonylethyl)-1H-pyrimidin-6-one |
| SMILES | CC(c1nc(-c2cnn(C)c2)cc(=O)[nH]1)S(C)(=O)=O |
| InChI | InChI=1S/C11H14N4O3S/c1-7(19(3,17)18)11-13-9(4-10(16)14-11)8-5-12-15(2)6-8/h4-7H,1-3H3,(H,13,14,16) |
| InChIKey | RAYRREWEMAQZDS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |