C11H15BrIN3O — CID 136772460
4-[4-(1-bromoethyl)piperidin-1-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136772460) has the molecular formula C11H15BrIN3O and a molecular weight of 412.07 g/mol. Its IUPAC name is 4-[4-(1-bromoethyl)piperidin-1-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(1-bromoethyl)piperidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136772460 |
| Molecular Formula | C11H15BrIN3O |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 4-[4-(1-bromoethyl)piperidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(Br)C1CCN(c2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C11H15BrIN3O/c1-7(12)8-2-4-16(5-3-8)10-9(13)11(17)15-6-14-10/h6-8H,2-5H2,1H3,(H,14,15,17) |
| InChIKey | NYRJGPLGYJCQQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|