C14H14N4O2 — CID 136772941
(1Z,4Z)-1,4-dihydrazinylidene-2,3-dihydroanthracene-9,10-diol (PubChem CID 136772941) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is (1Z,4Z)-1,4-dihydrazinylidene-2,3-dihydroanthracene-9,10-diol.
| Compound Name | (1Z,4Z)-1,4-dihydrazinylidene-2,3-dihydroanthracene-9,10-diol |
|---|---|
| PubChem CID | 136772941 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1Z,4Z)-1,4-dihydrazinylidene-2,3-dihydroanthracene-9,10-diol |
| SMILES | N/N=C1/CC/C(=N/N)c2c1c(O)c1ccccc1c2O |
| InChI | InChI=1S/C14H14N4O2/c15-17-9-5-6-10(18-16)12-11(9)13(19)7-3-1-2-4-8(7)14(12)20/h1-4,19-20H,5-6,15-16H2/b17-9-,18-10- |
| InChIKey | HPUYRUJWBAROKI-XFQWXJFMSA-N |
| XLogP | 1.37 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|