C21H29NO — CID 136773230
2-(1-adamantyliminomethyl)-6-tert-butylphenol (PubChem CID 136773230) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-(1-adamantyliminomethyl)-6-tert-butylphenol.
| Compound Name | 2-(1-adamantyliminomethyl)-6-tert-butylphenol |
|---|---|
| PubChem CID | 136773230 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-(1-adamantyliminomethyl)-6-tert-butylphenol |
| SMILES | CC(C)(C)c1cccc(/C=N/C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C21H29NO/c1-20(2,3)18-6-4-5-17(19(18)23)13-22-21-10-14-7-15(11-21)9-16(8-14)12-21/h4-6,13-16,23H,7-12H2,1-3H3/b22-13+ |
| InChIKey | GCGNFAYTHUXNCN-LPYMAVHISA-N |
| XLogP | 5.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|