C17H17N3O7 — CID 136773662
N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-(2-nitrophenoxy)acetamide (PubChem CID 136773662) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 136773662 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-(2-nitrophenoxy)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccccc2[N+](=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C17H17N3O7/c1-25-14-7-11(8-15(26-2)17(14)22)9-18-19-16(21)10-27-13-6-4-3-5-12(13)20(23)24/h3-9,22H,10H2,1-2H3,(H,19,21)/b18-9- |
| InChIKey | DSLWFXFEIOBADP-NVMNQCDNSA-N |
| XLogP | 1.85 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|