C15H11Cl2N3OS — CID 136773710
(5R)-5-[(2,5-dichlorophenyl)methyl]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 136773710) has the molecular formula C15H11Cl2N3OS and a molecular weight of 352.25 g/mol. Its IUPAC name is (5R)-5-[(2,5-dichlorophenyl)methyl]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-[(2,5-dichlorophenyl)methyl]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136773710 |
| Molecular Formula | C15H11Cl2N3OS |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | (5R)-5-[(2,5-dichlorophenyl)methyl]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=Nc2ccccn2)S[C@@H]1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2N3OS/c16-10-4-5-11(17)9(7-10)8-12-14(21)20-15(22-12)19-13-3-1-2-6-18-13/h1-7,12H,8H2,(H,18,19,20,21)/t12-/m1/s1 |
| InChIKey | LJBNPTDSLKODJY-GFCCVEGCSA-N |
| XLogP | 3.85 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|