C6H6N4O3 — CID 136773887
2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 136773887) has the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. Its IUPAC name is 2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 136773887 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | COc1nc2n(n1)C(=O)CC(=O)N2 |
| InChI | InChI=1S/C6H6N4O3/c1-13-6-8-5-7-3(11)2-4(12)10(5)9-6/h2H2,1H3,(H,7,8,9,11) |
| InChIKey | LMWXPRKFTPJEIJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|