C7H8N4O2 — CID 136773900
6-ethyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 136773900) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 6-ethyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 6-ethyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 136773900 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-ethyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | CCC1C(=O)Nc2ncnn2C1=O |
| InChI | InChI=1S/C7H8N4O2/c1-2-4-5(12)10-7-8-3-9-11(7)6(4)13/h3-4H,2H2,1H3,(H,8,9,10,12) |
| InChIKey | PDFGPFDXAVVNIO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|