About 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one
1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one (PubChem CID 136773914) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one.
Analyze 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one?
The IUPAC name of 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one (CID 136773914) is 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one.
What is the SMILES notation for 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one?
The canonical SMILES for 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one is O=c1[nH]c2ccnn2c2c1CCC2.
What is the InChIKey of 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one?
The InChIKey is BMPIBASHEOWGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c13-9-6-2-1-3-7(6)12-8(11-9)4-5-10-12/h4-5H,1-3H2,(H,11,13).
What are the key properties of 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one?
1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one has a molecular weight of 175.19 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one is sourced from PubChem (CID 136773914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).