C17H17N6O2- — CID 136775446
4-[(2,4-dimethylphenyl)diazenyl]-3-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-olate (PubChem CID 136775446) has the molecular formula C17H17N6O2- and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)diazenyl]-3-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-olate.
| Compound Name | 4-[(2,4-dimethylphenyl)diazenyl]-3-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-olate |
|---|---|
| PubChem CID | 136775446 |
| Molecular Formula | C17H17N6O2- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)diazenyl]-3-methyl-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-olate |
| SMILES | Cc1ccc(/N=N/c2c(C)nn(-c3nc(C)cc(=O)[nH]3)c2[O-])c(C)c1 |
| InChI | InChI=1S/C17H18N6O2/c1-9-5-6-13(10(2)7-9)20-21-15-12(4)22-23(16(15)25)17-18-11(3)8-14(24)19-17/h5-8,25H,1-4H3,(H,18,19,24)/p-1/b21-20+ |
| InChIKey | GPUZTIPEWVNQDU-QZQOTICOSA-M |
| XLogP | 2.68 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|