C11H16N4O3 — CID 136776020
2-[7-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid (PubChem CID 136776020) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[7-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[7-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 136776020 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[7-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid |
| SMILES | O=C(O)Cc1nc2n(n1)C(C1CCOC1)CCN2 |
| InChI | InChI=1S/C11H16N4O3/c16-10(17)5-9-13-11-12-3-1-8(15(11)14-9)7-2-4-18-6-7/h7-8H,1-6H2,(H,16,17)(H,12,13,14) |
| InChIKey | MZXFOQDHAPDAGT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |