C10H14N4O3 — CID 136776189
(3S)-1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid (PubChem CID 136776189) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is (3S)-1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 136776189 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (3S)-1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid |
| SMILES | Nc1nc(N2CCC[C@H](C(=O)O)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H14N4O3/c11-10-12-7(4-8(15)13-10)14-3-1-2-6(5-14)9(16)17/h4,6H,1-3,5H2,(H,16,17)(H3,11,12,13,15)/t6-/m0/s1 |
| InChIKey | ZRZCGEJZCGOHBL-LURJTMIESA-N |
| XLogP | -0.35 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |