About 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one
2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one (PubChem CID 136776198) has the molecular formula C8H14N4O3
and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
| PubChem CID | 136776198 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
| SMILES | COC(CNc1cc(=O)[nH]c(N)n1)OC |
| InChI | InChI=1S/C8H14N4O3/c1-14-7(15-2)4-10-5-3-6(13)12-8(9)11-5/h3,7H,4H2,1-2H3,(H4,9,10,11,12,13) |
| InChIKey | CUHIWARGFIDTLC-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The IUPAC name of 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one (CID 136776198) is 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The canonical SMILES for 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one is COC(CNc1cc(=O)[nH]c(N)n1)OC.
What is the InChIKey of 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The InChIKey is CUHIWARGFIDTLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O3/c1-14-7(15-2)4-10-5-3-6(13)12-8(9)11-5/h3,7H,4H2,1-2H3,(H4,9,10,11,12,13).
What are the key properties of 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one has a molecular weight of 214.23 g/mol, XLogP of -0.62, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 136776198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).