C21H16N4O3 — CID 136776464
4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2,6-dimethoxyphenol (PubChem CID 136776464) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2,6-dimethoxyphenol.
| Compound Name | 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 136776464 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc(OC)c1O |
| InChI | InChI=1S/C21H16N4O3/c1-27-14-9-11(10-15(28-2)20(14)26)21-24-18-12-5-3-7-22-16(12)17-13(19(18)25-21)6-4-8-23-17/h3-10,26H,1-2H3,(H,24,25) |
| InChIKey | CAFMAVLCVZSOGS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|