C32H49N5O2 — CID 136778143
10,24-ditert-butyl-3,6-dimethyl-3,6,14,17,20-pentazatricyclo[20.3.1.18,12]heptacosa-1(26),8(27),9,11,13,20,22,24-octaene-26,27-diol (PubChem CID 136778143) has the molecular formula C32H49N5O2 and a molecular weight of 535.78 g/mol. Its IUPAC name is 10,24-ditert-butyl-3,6-dimethyl-3,6,14,17,20-pentazatricyclo[20.3.1.18,12]heptacosa-1(26),8(27),9,11,13,20,22,24-octaene-26,27-diol.
| Compound Name | 10,24-ditert-butyl-3,6-dimethyl-3,6,14,17,20-pentazatricyclo[20.3.1.18,12]heptacosa-1(26),8(27),9,11,13,20,22,24-octaene-26,27-diol |
|---|---|
| PubChem CID | 136778143 |
| Molecular Formula | C32H49N5O2 |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.39 |
| IUPAC Name | 10,24-ditert-butyl-3,6-dimethyl-3,6,14,17,20-pentazatricyclo[20.3.1.18,12]heptacosa-1(26),8(27),9,11,13,20,22,24-octaene-26,27-diol |
| SMILES | CN1CCN(C)Cc2cc(C(C)(C)C)cc(c2O)/C=N\CCNCC/N=C\c2cc(C(C)(C)C)cc(c2O)C1 |
| InChI | InChI=1S/C32H49N5O2/c1-31(2,3)27-15-23-19-34-11-9-33-10-12-35-20-24-16-28(32(4,5)6)18-26(30(24)39)22-37(8)14-13-36(7)21-25(17-27)29(23)38/h15-20,33,38-39H,9-14,21-22H2,1-8H3/b34-19-,35-20- |
| InChIKey | GZKMDFOJZUSVHH-PDHAQUIHSA-N |
| XLogP | 4.70 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|