C16H16N4OS — CID 136778682
3-(4-ethylanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136778682) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 3-(4-ethylanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-ethylanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136778682 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(4-ethylanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | CCc1ccc(Nc2nnc(Cc3cccs3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H16N4OS/c1-2-11-5-7-12(8-6-11)17-16-18-15(21)14(19-20-16)10-13-4-3-9-22-13/h3-9H,2,10H2,1H3,(H2,17,18,20,21) |
| InChIKey | PFBZPIQXVSEBCO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |