C15H10F2N4O — CID 136779310
3-(2,5-difluoroanilino)-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 136779310) has the molecular formula C15H10F2N4O and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-(2,5-difluoroanilino)-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2,5-difluoroanilino)-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779310 |
| Molecular Formula | C15H10F2N4O |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-(2,5-difluoroanilino)-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2cc(F)ccc2F)nnc1-c1ccccc1 |
| InChI | InChI=1S/C15H10F2N4O/c16-10-6-7-11(17)12(8-10)18-15-19-14(22)13(20-21-15)9-4-2-1-3-5-9/h1-8H,(H2,18,19,21,22) |
| InChIKey | VMUFOWMTBYGQRR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |