C16H21FN4O2 — CID 136779991
6-[(4-fluorophenyl)methyl]-3-(3-propan-2-yloxypropylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136779991) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-(3-propan-2-yloxypropylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-(3-propan-2-yloxypropylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779991 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-(3-propan-2-yloxypropylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)OCCCNc1nnc(Cc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H21FN4O2/c1-11(2)23-9-3-8-18-16-19-15(22)14(20-21-16)10-12-4-6-13(17)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | PWZNAQNEIDIHPC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|