C12H19BrN4O2 — CID 136781030
5-bromo-4-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136781030) has the molecular formula C12H19BrN4O2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 5-bromo-4-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136781030 |
| Molecular Formula | C12H19BrN4O2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5-bromo-4-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]-1H-pyrimidin-6-one |
| SMILES | COCCN(CC1CCCN1)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C12H19BrN4O2/c1-19-6-5-17(7-9-3-2-4-14-9)11-10(13)12(18)16-8-15-11/h8-9,14H,2-7H2,1H3,(H,15,16,18) |
| InChIKey | FUPXGTNBOCVQHZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |