C12H20N4O3 — CID 136781034
4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136781034) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136781034 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N(CCO)CC2CCCN2)nc[nH]c1=O |
| InChI | InChI=1S/C12H20N4O3/c1-19-10-11(14-8-15-12(10)18)16(5-6-17)7-9-3-2-4-13-9/h8-9,13,17H,2-7H2,1H3,(H,14,15,18) |
| InChIKey | LRMBJXQXUCMZTJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |