C12H10BrClN2O — CID 136781996
2-(5-bromo-2-chlorophenyl)-4,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 136781996) has the molecular formula C12H10BrClN2O and a molecular weight of 313.58 g/mol. Its IUPAC name is 2-(5-bromo-2-chlorophenyl)-4,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 2-(5-bromo-2-chlorophenyl)-4,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136781996 |
| Molecular Formula | C12H10BrClN2O |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 2-(5-bromo-2-chlorophenyl)-4,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2cc(Br)ccc2Cl)[nH]c(=O)c1C |
| InChI | InChI=1S/C12H10BrClN2O/c1-6-7(2)15-11(16-12(6)17)9-5-8(13)3-4-10(9)14/h3-5H,1-2H3,(H,15,16,17) |
| InChIKey | DMXGLUZPWDVCQT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |