C14H10N4O — CID 136782420
4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1H-pyrrole-2-carbonitrile (PubChem CID 136782420) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1H-pyrrole-2-carbonitrile.
| Compound Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 136782420 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(-c2nc(Cc3ccccc3)no2)c[nH]1 |
| InChI | InChI=1S/C14H10N4O/c15-8-12-7-11(9-16-12)14-17-13(18-19-14)6-10-4-2-1-3-5-10/h1-5,7,9,16H,6H2 |
| InChIKey | WYFVTDNHCFZNKR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |