C10H13BrIN3O2 — CID 136783263
4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136783263) has the molecular formula C10H13BrIN3O2 and a molecular weight of 414.04 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136783263 |
| Molecular Formula | C10H13BrIN3O2 |
| Molecular Weight | 414.04 g/mol |
| Exact Mass | 412.92 |
| IUPAC Name | 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1CN(c2nc[nH]c(=O)c2I)CC(CBr)O1 |
| InChI | InChI=1S/C10H13BrIN3O2/c1-6-3-15(4-7(2-11)17-6)9-8(12)10(16)14-5-13-9/h5-7H,2-4H2,1H3,(H,13,14,16) |
| InChIKey | XQKSVHNFMDYNLX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.04 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|