C20H22BrClF3N5O2 — CID 136783579
(5R,7R)-7-(4-bromophenyl)-3-chloro-N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxamide (PubChem CID 136783579) has the molecular formula C20H22BrClF3N5O2 and a molecular weight of 536.78 g/mol. Its IUPAC name is (5R,7R)-7-(4-bromophenyl)-3-chloro-N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-7-(4-bromophenyl)-3-chloro-N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136783579 |
| Molecular Formula | C20H22BrClF3N5O2 |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | (5R,7R)-7-(4-bromophenyl)-3-chloro-N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1nc2n(c1Cl)[C@@H](C(F)(F)F)C[C@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C20H22BrClF3N5O2/c21-13-3-1-12(2-4-13)14-11-15(20(23,24)25)30-17(22)16(28-19(30)27-14)18(31)26-5-6-29-7-9-32-10-8-29/h1-4,14-15H,5-11H2,(H,26,31)(H,27,28)/t14-,15-/m1/s1 |
| InChIKey | RDWKACQCFWPBPV-HUUCEWRRSA-N |
| XLogP | 4.02 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |