C17H13Br2N3O2 — CID 136783661
3,5-dibromo-N-[(Z)-1H-indol-3-ylmethylideneamino]-4-methoxybenzamide (PubChem CID 136783661) has the molecular formula C17H13Br2N3O2 and a molecular weight of 451.12 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-1H-indol-3-ylmethylideneamino]-4-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-1H-indol-3-ylmethylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 136783661 |
| Molecular Formula | C17H13Br2N3O2 |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-1H-indol-3-ylmethylideneamino]-4-methoxybenzamide |
| SMILES | COc1c(Br)cc(C(=O)N/N=C\c2c[nH]c3ccccc23)cc1Br |
| InChI | InChI=1S/C17H13Br2N3O2/c1-24-16-13(18)6-10(7-14(16)19)17(23)22-21-9-11-8-20-15-5-3-2-4-12(11)15/h2-9,20H,1H3,(H,22,23)/b21-9- |
| InChIKey | PPNSVRBAEBSBGM-NKVSQWTQSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|