C26H29N3O5 — CID 136783958
(4R)-5-(3-ethoxypropyl)-3-(2-hydroxyphenyl)-4-(3-methoxy-4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 136783958) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is (4R)-5-(3-ethoxypropyl)-3-(2-hydroxyphenyl)-4-(3-methoxy-4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | (4R)-5-(3-ethoxypropyl)-3-(2-hydroxyphenyl)-4-(3-methoxy-4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 136783958 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (4R)-5-(3-ethoxypropyl)-3-(2-hydroxyphenyl)-4-(3-methoxy-4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | C=CCOc1ccc([C@@H]2c3c(-c4ccccc4O)n[nH]c3C(=O)N2CCCOCC)cc1OC |
| InChI | InChI=1S/C26H29N3O5/c1-4-14-34-20-12-11-17(16-21(20)32-3)25-22-23(18-9-6-7-10-19(18)30)27-28-24(22)26(31)29(25)13-8-15-33-5-2/h4,6-7,9-12,16,25,30H,1,5,8,13-15H2,2-3H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | WKNMJEZUUFXUSO-RUZDIDTESA-N |
| XLogP | 4.33 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|