About 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol
3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol (PubChem CID 136784298) has the molecular formula C16H11BrClN3O2
and a molecular weight of 392.64 g/mol. Its IUPAC name is 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol |
| PubChem CID | 136784298 |
| Molecular Formula | C16H11BrClN3O2 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol |
| SMILES | Oc1c(Cl)c(/N=N/c2ccc(Br)cc2)c(O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H11BrClN3O2/c17-10-6-8-11(9-7-10)19-20-14-13(18)15(22)21(16(14)23)12-4-2-1-3-5-12/h1-9,22-23H/b20-19+ |
| InChIKey | RDJIQZFQBSUCQK-FMQUCBEESA-N |
| XLogP | 5.72 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol?
The IUPAC name of 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol (CID 136784298) is 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol.
What is the SMILES notation for 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol?
The canonical SMILES for 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol is Oc1c(Cl)c(/N=N/c2ccc(Br)cc2)c(O)n1-c1ccccc1.
What is the InChIKey of 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol?
The InChIKey is RDJIQZFQBSUCQK-FMQUCBEESA-N. The full InChI is InChI=1S/C16H11BrClN3O2/c17-10-6-8-11(9-7-10)19-20-14-13(18)15(22)21(16(14)23)12-4-2-1-3-5-12/h1-9,22-23H/b20-19+.
What are the key properties of 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol?
3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol has a molecular weight of 392.64 g/mol, XLogP of 5.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromophenyl)diazenyl]-4-chloro-1-phenylpyrrole-2,5-diol is sourced from PubChem (CID 136784298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).