About N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide
N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide (PubChem CID 136784814) has the molecular formula C13H19N3O2S2
and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide |
| PubChem CID | 136784814 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCC/N=C1/NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-20(17,18)15-9-5-8-14-13-16-12(10-19-13)11-6-3-2-4-7-11/h2-4,6-7,12,15H,5,8-10H2,1H3,(H,14,16) |
| InChIKey | KKKYLFSZVQKSHH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide?
The IUPAC name of N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide (CID 136784814) is N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide.
What is the SMILES notation for N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide?
The canonical SMILES for N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide is CS(=O)(=O)NCCC/N=C1/NC(c2ccccc2)CS1.
What is the InChIKey of N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide?
The InChIKey is KKKYLFSZVQKSHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S2/c1-20(17,18)15-9-5-8-14-13-16-12(10-19-13)11-6-3-2-4-7-11/h2-4,6-7,12,15H,5,8-10H2,1H3,(H,14,16).
What are the key properties of N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide?
N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide has a molecular weight of 313.45 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]propyl]methanesulfonamide is sourced from PubChem (CID 136784814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).