C11H14BF3N2O3 — CID 136785592
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136785592) has the molecular formula C11H14BF3N2O3 and a molecular weight of 290.05 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136785592 |
| Molecular Formula | C11H14BF3N2O3 |
| Molecular Weight | 290.05 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CC1(C)OB(c2c(C(F)(F)F)nc[nH]c2=O)OC1(C)C |
| InChI | InChI=1S/C11H14BF3N2O3/c1-9(2)10(3,4)20-12(19-9)6-7(11(13,14)15)16-5-17-8(6)18/h5H,1-4H3,(H,16,17,18) |
| InChIKey | OYVNZROAPUPZRL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.05 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|