C11H15F3N6OS — CID 136786181
1-methyl-3-[[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]thiourea (PubChem CID 136786181) has the molecular formula C11H15F3N6OS and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-methyl-3-[[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]thiourea.
| Compound Name | 1-methyl-3-[[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 136786181 |
| Molecular Formula | C11H15F3N6OS |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-methyl-3-[[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]thiourea |
| SMILES | CNC(=S)NNC(=O)c1cnn2c1N[C@@H](C)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C11H15F3N6OS/c1-5-3-7(11(12,13)14)20-8(17-5)6(4-16-20)9(21)18-19-10(22)15-2/h4-5,7,17H,3H2,1-2H3,(H,18,21)(H2,15,19,22)/t5-,7+/m0/s1 |
| InChIKey | GTRTXACPQUOIBX-CAHLUQPWSA-N |
| XLogP | 0.93 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|