C25H28N4O4 — CID 136788310
2-[(2Z)-2-[2-(2-hexoxyphenyl)-2-oxoethylidene]hydrazinyl]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 136788310) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[(2Z)-2-[2-(2-hexoxyphenyl)-2-oxoethylidene]hydrazinyl]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[2-(2-hexoxyphenyl)-2-oxoethylidene]hydrazinyl]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136788310 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[(2Z)-2-[2-(2-hexoxyphenyl)-2-oxoethylidene]hydrazinyl]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | CCCCCCOc1ccccc1C(=O)/C=N\Nc1nc(-c2ccc(OC)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C25H28N4O4/c1-3-4-5-8-15-33-23-10-7-6-9-20(23)22(30)17-26-29-25-27-21(16-24(31)28-25)18-11-13-19(32-2)14-12-18/h6-7,9-14,16-17H,3-5,8,15H2,1-2H3,(H2,27,28,29,31)/b26-17- |
| InChIKey | HYWBLRHTNORNMA-ONUIUJJFSA-N |
| XLogP | 4.69 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|